C30H39ClN6O8 — CID 159574028
4-chloro-2-methoxy-1-nitrobenzene;1-(3,8-diazabicyclo[3.2.1]octan-8-yl)ethanone;1-[3-(3-methoxy-4-nitrophenyl)-3,8-diazabicyclo[3.2.1]octan-8-yl]ethanone (PubChem CID 159574028) has the molecular formula C30H39ClN6O8 and a molecular weight of 647.13 g/mol. Its IUPAC name is 4-chloro-2-methoxy-1-nitrobenzene;1-(3,8-diazabicyclo[3.2.1]octan-8-yl)ethanone;1-[3-(3-methoxy-4-nitrophenyl)-3,8-diazabicyclo[3.2.1]octan-8-yl]ethanone.
| Compound Name | 4-chloro-2-methoxy-1-nitrobenzene;1-(3,8-diazabicyclo[3.2.1]octan-8-yl)ethanone;1-[3-(3-methoxy-4-nitrophenyl)-3,8-diazabicyclo[3.2.1]octan-8-yl]ethanone |
|---|---|
| PubChem CID | 159574028 |
| Molecular Formula | C30H39ClN6O8 |
| Molecular Weight | 647.13 g/mol |
| Exact Mass | 646.25 |
| IUPAC Name | 4-chloro-2-methoxy-1-nitrobenzene;1-(3,8-diazabicyclo[3.2.1]octan-8-yl)ethanone;1-[3-(3-methoxy-4-nitrophenyl)-3,8-diazabicyclo[3.2.1]octan-8-yl]ethanone |
| SMILES | CC(=O)N1C2CCC1CNC2.COc1cc(Cl)ccc1[N+](=O)[O-].COc1cc(N2CC3CCC(C2)N3C(C)=O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H19N3O4.C8H14N2O.C7H6ClNO3/c1-10(19)17-12-3-4-13(17)9-16(8-12)11-5-6-14(18(20)21)15(7-11)22-2;1-6(11)10-7-2-3-8(10)5-9-4-7;1-12-7-4-5(8)2-3-6(7)9(10)11/h5-7,12-13H,3-4,8-9H2,1-2H3;7-9H,2-5H2,1H3;2-4H,1H3 |
| InChIKey | MIECZHZGSYUJDL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 160.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.13 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|