C23H37NO12 — CID 159575664
3-(3-formyloxy-2-oxopropyl)-5-oxo-8-[2-[2-oxo-2-[2-[2-(2-oxopropoxy)ethoxy]ethylamino]ethoxy]ethoxy]octanoic acid (PubChem CID 159575664) has the molecular formula C23H37NO12 and a molecular weight of 519.54 g/mol. Its IUPAC name is 3-(3-formyloxy-2-oxopropyl)-5-oxo-8-[2-[2-oxo-2-[2-[2-(2-oxopropoxy)ethoxy]ethylamino]ethoxy]ethoxy]octanoic acid.
| Compound Name | 3-(3-formyloxy-2-oxopropyl)-5-oxo-8-[2-[2-oxo-2-[2-[2-(2-oxopropoxy)ethoxy]ethylamino]ethoxy]ethoxy]octanoic acid |
|---|---|
| PubChem CID | 159575664 |
| Molecular Formula | C23H37NO12 |
| Molecular Weight | 519.54 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | 3-(3-formyloxy-2-oxopropyl)-5-oxo-8-[2-[2-oxo-2-[2-[2-(2-oxopropoxy)ethoxy]ethylamino]ethoxy]ethoxy]octanoic acid |
| SMILES | CC(=O)COCCOCCNC(=O)COCCOCCCC(=O)CC(CC(=O)O)CC(=O)COC=O |
| InChI | InChI=1S/C23H37NO12/c1-18(26)14-34-9-8-33-6-4-24-22(29)16-35-10-7-32-5-2-3-20(27)11-19(13-23(30)31)12-21(28)15-36-17-25/h17,19H,2-16H2,1H3,(H,24,29)(H,30,31) |
| InChIKey | DCOZWORPWDCMNM-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 180.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.54 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|