C13H22N8 — CID 159581463
8-ethyl-4-N,6-N,6-N-trimethyl-2-[methyl(methylamino)amino]pyrimido[5,4-d]pyrimidine-4,6-diamine (PubChem CID 159581463) has the molecular formula C13H22N8 and a molecular weight of 290.38 g/mol. Its IUPAC name is 8-ethyl-4-N,6-N,6-N-trimethyl-2-[methyl(methylamino)amino]pyrimido[5,4-d]pyrimidine-4,6-diamine.
| Compound Name | 8-ethyl-4-N,6-N,6-N-trimethyl-2-[methyl(methylamino)amino]pyrimido[5,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 159581463 |
| Molecular Formula | C13H22N8 |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 8-ethyl-4-N,6-N,6-N-trimethyl-2-[methyl(methylamino)amino]pyrimido[5,4-d]pyrimidine-4,6-diamine |
| SMILES | CCc1nc(N(C)C)nc2c(NC)nc(N(C)NC)nc12 |
| InChI | InChI=1S/C13H22N8/c1-7-8-9-10(18-12(16-8)20(4)5)11(14-2)19-13(17-9)21(6)15-3/h15H,7H2,1-6H3,(H,14,17,19) |
| InChIKey | KVXXZTVTYPEACV-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 82.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|