C11H16ClN7 — CID 159581462
6-chloro-8-ethyl-N-methyl-2-[methyl(methylamino)amino]pyrimido[5,4-d]pyrimidin-4-amine (PubChem CID 159581462) has the molecular formula C11H16ClN7 and a molecular weight of 281.75 g/mol. Its IUPAC name is 6-chloro-8-ethyl-N-methyl-2-[methyl(methylamino)amino]pyrimido[5,4-d]pyrimidin-4-amine.
| Compound Name | 6-chloro-8-ethyl-N-methyl-2-[methyl(methylamino)amino]pyrimido[5,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 159581462 |
| Molecular Formula | C11H16ClN7 |
| Molecular Weight | 281.75 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 6-chloro-8-ethyl-N-methyl-2-[methyl(methylamino)amino]pyrimido[5,4-d]pyrimidin-4-amine |
| SMILES | CCc1nc(Cl)nc2c(NC)nc(N(C)NC)nc12 |
| InChI | InChI=1S/C11H16ClN7/c1-5-6-7-8(16-10(12)15-6)9(13-2)18-11(17-7)19(4)14-3/h14H,5H2,1-4H3,(H,13,17,18) |
| InChIKey | HTSYHFBGWMSSMI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 78.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.75 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|