C8H26O4Si4 — CID 159589523
dimethylsilyloxy-methoxy-dimethylsilane;2,2,4-trimethyl-1,3,2,4-dioxadisiletane (PubChem CID 159589523) has the molecular formula C8H26O4Si4 and a molecular weight of 298.64 g/mol. Its IUPAC name is dimethylsilyloxy-methoxy-dimethylsilane;2,2,4-trimethyl-1,3,2,4-dioxadisiletane.
| Compound Name | dimethylsilyloxy-methoxy-dimethylsilane;2,2,4-trimethyl-1,3,2,4-dioxadisiletane |
|---|---|
| PubChem CID | 159589523 |
| Molecular Formula | C8H26O4Si4 |
| Molecular Weight | 298.64 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | dimethylsilyloxy-methoxy-dimethylsilane;2,2,4-trimethyl-1,3,2,4-dioxadisiletane |
| SMILES | CO[Si](C)(C)O[SiH](C)C.C[SiH]1O[Si](C)(C)O1 |
| InChI | InChI=1S/C5H16O2Si2.C3H10O2Si2/c1-6-9(4,5)7-8(2)3;1-6-4-7(2,3)5-6/h8H,1-5H3;6H,1-3H3 |
| InChIKey | MKBCFKSJSRGJTP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.64 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|