C23H20N6O2 — CID 159605422
5-[6-(5-ethyltetrazol-1-yl)-5-methyl-3-pyridinyl]-1H-benzo[g][1]benzazepine-2,4-dione (PubChem CID 159605422) has the molecular formula C23H20N6O2 and a molecular weight of 412.45 g/mol. Its IUPAC name is 5-[6-(5-ethyltetrazol-1-yl)-5-methyl-3-pyridinyl]-1H-benzo[g][1]benzazepine-2,4-dione.
| Compound Name | 5-[6-(5-ethyltetrazol-1-yl)-5-methyl-3-pyridinyl]-1H-benzo[g][1]benzazepine-2,4-dione |
|---|---|
| PubChem CID | 159605422 |
| Molecular Formula | C23H20N6O2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 5-[6-(5-ethyltetrazol-1-yl)-5-methyl-3-pyridinyl]-1H-benzo[g][1]benzazepine-2,4-dione |
| SMILES | CCc1nnnn1-c1ncc(N2C(=O)CC(=O)Cc3c2ccc2ccccc32)cc1C |
| InChI | InChI=1S/C23H20N6O2/c1-3-21-25-26-27-29(21)23-14(2)10-16(13-24-23)28-20-9-8-15-6-4-5-7-18(15)19(20)11-17(30)12-22(28)31/h4-10,13H,3,11-12H2,1-2H3 |
| InChIKey | MMADKQGKPPGSQD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 93.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|