C27H27N3O4 — CID 159647711
2-(oxan-4-yl)ethyl 2-[3-[[1-(3-cyanophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]acetate (PubChem CID 159647711) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is 2-(oxan-4-yl)ethyl 2-[3-[[1-(3-cyanophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]acetate.
| Compound Name | 2-(oxan-4-yl)ethyl 2-[3-[[1-(3-cyanophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]acetate |
|---|---|
| PubChem CID | 159647711 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 2-(oxan-4-yl)ethyl 2-[3-[[1-(3-cyanophenyl)-4-oxopyridazin-3-yl]methyl]phenyl]acetate |
| SMILES | N#Cc1cccc(-n2ccc(=O)c(Cc3cccc(CC(=O)OCCC4CCOCC4)c3)n2)c1 |
| InChI | InChI=1S/C27H27N3O4/c28-19-23-5-2-6-24(16-23)30-11-7-26(31)25(29-30)17-21-3-1-4-22(15-21)18-27(32)34-14-10-20-8-12-33-13-9-20/h1-7,11,15-16,20H,8-10,12-14,17-18H2 |
| InChIKey | MRDXTPWPFCBVKJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 94.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |