C18H26F8N2O5 — CID 159652093
2-[2-(8-acetamido-1,1-difluoro-2-oxooctoxy)-1,1,2,2-tetrafluoroethoxy]-N,N-diethyl-2,2-difluoroacetamide (PubChem CID 159652093) has the molecular formula C18H26F8N2O5 and a molecular weight of 502.40 g/mol. Its IUPAC name is 2-[2-(8-acetamido-1,1-difluoro-2-oxooctoxy)-1,1,2,2-tetrafluoroethoxy]-N,N-diethyl-2,2-difluoroacetamide.
| Compound Name | 2-[2-(8-acetamido-1,1-difluoro-2-oxooctoxy)-1,1,2,2-tetrafluoroethoxy]-N,N-diethyl-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 159652093 |
| Molecular Formula | C18H26F8N2O5 |
| Molecular Weight | 502.40 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | 2-[2-(8-acetamido-1,1-difluoro-2-oxooctoxy)-1,1,2,2-tetrafluoroethoxy]-N,N-diethyl-2,2-difluoroacetamide |
| SMILES | CCN(CC)C(=O)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(=O)CCCCCCNC(C)=O |
| InChI | InChI=1S/C18H26F8N2O5/c1-4-28(5-2)14(31)16(21,22)33-18(25,26)17(23,24)32-15(19,20)13(30)10-8-6-7-9-11-27-12(3)29/h4-11H2,1-3H3,(H,27,29) |
| InChIKey | NOKYCQRDYFUVIB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|