C38H40O4 — CID 159655476
1-[2-(3,4-dimethoxy-2-methylphenyl)-5-methylphenyl]prop-2-en-1-one;5,13,14,15-tetramethyltricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaen-8-one (PubChem CID 159655476) has the molecular formula C38H40O4 and a molecular weight of 560.73 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxy-2-methylphenyl)-5-methylphenyl]prop-2-en-1-one;5,13,14,15-tetramethyltricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaen-8-one.
| Compound Name | 1-[2-(3,4-dimethoxy-2-methylphenyl)-5-methylphenyl]prop-2-en-1-one;5,13,14,15-tetramethyltricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaen-8-one |
|---|---|
| PubChem CID | 159655476 |
| Molecular Formula | C38H40O4 |
| Molecular Weight | 560.73 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | 1-[2-(3,4-dimethoxy-2-methylphenyl)-5-methylphenyl]prop-2-en-1-one;5,13,14,15-tetramethyltricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaen-8-one |
| SMILES | C=CC(=O)c1cc(C)ccc1-c1ccc(OC)c(OC)c1C.Cc1ccc2c(c1)C(=O)CCc1cc(C)c(C)c(C)c1-2 |
| InChI | InChI=1S/C19H20O3.C19H20O/c1-6-17(20)16-11-12(2)7-8-15(16)14-9-10-18(21-4)19(22-5)13(14)3;1-11-5-7-16-17(9-11)18(20)8-6-15-10-12(2)13(3)14(4)19(15)16/h6-11H,1H2,2-5H3;5,7,9-10H,6,8H2,1-4H3 |
| InChIKey | MSCQTUGLPMVMSA-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.73 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|