C42H37ClO4 — CID 159666195
benzoic acid;9-chloro-2,7-dimethyl-9-phenylxanthene;1-methyl-4-(4-methylphenoxy)benzene (PubChem CID 159666195) has the molecular formula C42H37ClO4 and a molecular weight of 641.21 g/mol. Its IUPAC name is benzoic acid;9-chloro-2,7-dimethyl-9-phenylxanthene;1-methyl-4-(4-methylphenoxy)benzene.
| Compound Name | benzoic acid;9-chloro-2,7-dimethyl-9-phenylxanthene;1-methyl-4-(4-methylphenoxy)benzene |
|---|---|
| PubChem CID | 159666195 |
| Molecular Formula | C42H37ClO4 |
| Molecular Weight | 641.21 g/mol |
| Exact Mass | 640.24 |
| IUPAC Name | benzoic acid;9-chloro-2,7-dimethyl-9-phenylxanthene;1-methyl-4-(4-methylphenoxy)benzene |
| SMILES | Cc1ccc(Oc2ccc(C)cc2)cc1.Cc1ccc2c(c1)C(Cl)(c1ccccc1)c1cc(C)ccc1O2.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C21H17ClO.C14H14O.C7H6O2/c1-14-8-10-19-17(12-14)21(22,16-6-4-3-5-7-16)18-13-15(2)9-11-20(18)23-19;1-11-3-7-13(8-4-11)15-14-9-5-12(2)6-10-14;8-7(9)6-4-2-1-3-5-6/h3-13H,1-2H3;3-10H,1-2H3;1-5H,(H,8,9) |
| InChIKey | MTKUQBFOLFQQHC-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.21 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|