C9H13ClN5Y- — CID 159681807
1-(diaminomethylidene)-2-(3-methylbenzene-4-id-1-yl)guanidine;yttrium;hydrochloride (PubChem CID 159681807) has the molecular formula C9H13ClN5Y- and a molecular weight of 315.60 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-(3-methylbenzene-4-id-1-yl)guanidine;yttrium;hydrochloride.
| Compound Name | 1-(diaminomethylidene)-2-(3-methylbenzene-4-id-1-yl)guanidine;yttrium;hydrochloride |
|---|---|
| PubChem CID | 159681807 |
| Molecular Formula | C9H13ClN5Y- |
| Molecular Weight | 315.60 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | 1-(diaminomethylidene)-2-(3-methylbenzene-4-id-1-yl)guanidine;yttrium;hydrochloride |
| SMILES | Cc1[c-]ccc(/N=C(\N)N=C(N)N)c1.Cl.[Y] |
| InChI | InChI=1S/C9H12N5.ClH.Y/c1-6-3-2-4-7(5-6)13-9(12)14-8(10)11;;/h2,4-5H,1H3,(H6,10,11,12,13,14);1H;/q-1;; |
| InChIKey | WSKRUKPESCCYLS-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.60 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|