C8H13N5 — CID 146593506
2-cyclohexa-1,5-dien-1-yl-1-(diaminomethylidene)guanidine (PubChem CID 146593506) has the molecular formula C8H13N5 and a molecular weight of 179.23 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-1-(diaminomethylidene)guanidine.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 146593506 |
| Molecular Formula | C8H13N5 |
| Molecular Weight | 179.23 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-1-(diaminomethylidene)guanidine |
| SMILES | NC(N)=N/C(N)=N/C1=CCCC=C1 |
| InChI | InChI=1S/C8H13N5/c9-7(10)13-8(11)12-6-4-2-1-3-5-6/h2,4-5H,1,3H2,(H6,9,10,11,12,13) |
| InChIKey | SXAJIKLEBHNIHM-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.23 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|