C7H11N3 — CID 143973120
2-cyclohexa-1,5-dien-1-ylguanidine (PubChem CID 143973120) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-ylguanidine.
| Compound Name | 2-cyclohexa-1,5-dien-1-ylguanidine |
|---|---|
| PubChem CID | 143973120 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-ylguanidine |
| SMILES | NC(N)=NC1=CCCC=C1 |
| InChI | InChI=1S/C7H11N3/c8-7(9)10-6-4-2-1-3-5-6/h2,4-5H,1,3H2,(H4,8,9,10) |
| InChIKey | FMHJHVYHYAHRNS-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|