C13H14N4 — CID 163895491
1-cyano-2-[(1E,4Z,6Z,8Z)-cycloundeca-1,4,6,8,10-pentaen-1-yl]guanidine (PubChem CID 163895491) has the molecular formula C13H14N4 and a molecular weight of 226.28 g/mol. Its IUPAC name is 1-cyano-2-[(1E,4Z,6Z,8Z)-cycloundeca-1,4,6,8,10-pentaen-1-yl]guanidine.
| Compound Name | 1-cyano-2-[(1E,4Z,6Z,8Z)-cycloundeca-1,4,6,8,10-pentaen-1-yl]guanidine |
|---|---|
| PubChem CID | 163895491 |
| Molecular Formula | C13H14N4 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 1-cyano-2-[(1E,4Z,6Z,8Z)-cycloundeca-1,4,6,8,10-pentaen-1-yl]guanidine |
| SMILES | N#CN/C(N)=N/C1=C/C/C=C\C=C/C=C\C=C1 |
| InChI | InChI=1S/C13H14N4/c14-11-16-13(15)17-12-9-7-5-3-1-2-4-6-8-10-12/h1-7,9-10H,8H2,(H3,15,16,17)/b2-1-,5-3-,6-4-,9-7?,12-10+ |
| InChIKey | QFFPKKSOVUOBQT-FAXILPIASA-N |
| XLogP | 1.88 |
| TPSA | 74.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|