C7H11N5 — CID 157078721
2-cyclopenta-1,4-dien-1-yl-1-(diaminomethylidene)guanidine (PubChem CID 157078721) has the molecular formula C7H11N5 and a molecular weight of 165.20 g/mol. Its IUPAC name is 2-cyclopenta-1,4-dien-1-yl-1-(diaminomethylidene)guanidine.
| Compound Name | 2-cyclopenta-1,4-dien-1-yl-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 157078721 |
| Molecular Formula | C7H11N5 |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 2-cyclopenta-1,4-dien-1-yl-1-(diaminomethylidene)guanidine |
| SMILES | NC(N)=N/C(N)=N/C1=CCC=C1 |
| InChI | InChI=1S/C7H11N5/c8-6(9)12-7(10)11-5-3-1-2-4-5/h1,3-4H,2H2,(H6,8,9,10,11,12) |
| InChIKey | YESOZHNMOLAHHT-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|