C23H21F5I+ — CID 159687848
(4-methylphenyl)-(4-propan-2-ylphenyl)iodanium;1,2,3,4,5-pentafluoro-6-methylbenzene (PubChem CID 159687848) has the molecular formula C23H21F5I+ and a molecular weight of 519.32 g/mol. Its IUPAC name is (4-methylphenyl)-(4-propan-2-ylphenyl)iodanium;1,2,3,4,5-pentafluoro-6-methylbenzene.
| Compound Name | (4-methylphenyl)-(4-propan-2-ylphenyl)iodanium;1,2,3,4,5-pentafluoro-6-methylbenzene |
|---|---|
| PubChem CID | 159687848 |
| Molecular Formula | C23H21F5I+ |
| Molecular Weight | 519.32 g/mol |
| Exact Mass | 519.06 |
| IUPAC Name | (4-methylphenyl)-(4-propan-2-ylphenyl)iodanium;1,2,3,4,5-pentafluoro-6-methylbenzene |
| SMILES | Cc1c(F)c(F)c(F)c(F)c1F.Cc1ccc([I+]c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C16H18I.C7H3F5/c1-12(2)14-6-10-16(11-7-14)17-15-8-4-13(3)5-9-15;1-2-3(8)5(10)7(12)6(11)4(2)9/h4-12H,1-3H3;1H3/q+1; |
| InChIKey | MWAJSMYSDMUPPX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.32 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|