About methane;(4-methylphenyl)-(4-propan-2-ylphenyl)iodanium
methane;(4-methylphenyl)-(4-propan-2-ylphenyl)iodanium (PubChem CID 160535217) has the molecular formula C17H22I+
and a molecular weight of 353.27 g/mol. Its IUPAC name is methane;(4-methylphenyl)-(4-propan-2-ylphenyl)iodanium.
Molecular Properties
| Compound Name | methane;(4-methylphenyl)-(4-propan-2-ylphenyl)iodanium |
| PubChem CID | 160535217 |
| Molecular Formula | C17H22I+ |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | methane;(4-methylphenyl)-(4-propan-2-ylphenyl)iodanium |
| SMILES | C.Cc1ccc([I+]c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C16H18I.CH4/c1-12(2)14-6-10-16(11-7-14)17-15-8-4-13(3)5-9-15;/h4-12H,1-3H3;1H4/q+1; |
| InChIKey | QWBINKPEORUNLE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methane;(4-methylphenyl)-(4-propan-2-ylphenyl)iodanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;(4-methylphenyl)-(4-propan-2-ylphenyl)iodanium?
The IUPAC name of methane;(4-methylphenyl)-(4-propan-2-ylphenyl)iodanium (CID 160535217) is methane;(4-methylphenyl)-(4-propan-2-ylphenyl)iodanium.
What is the SMILES notation for methane;(4-methylphenyl)-(4-propan-2-ylphenyl)iodanium?
The canonical SMILES for methane;(4-methylphenyl)-(4-propan-2-ylphenyl)iodanium is C.Cc1ccc([I+]c2ccc(C(C)C)cc2)cc1.
What is the InChIKey of methane;(4-methylphenyl)-(4-propan-2-ylphenyl)iodanium?
The InChIKey is QWBINKPEORUNLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18I.CH4/c1-12(2)14-6-10-16(11-7-14)17-15-8-4-13(3)5-9-15;/h4-12H,1-3H3;1H4/q+1;.
What are the key properties of methane;(4-methylphenyl)-(4-propan-2-ylphenyl)iodanium?
methane;(4-methylphenyl)-(4-propan-2-ylphenyl)iodanium has a molecular weight of 353.27 g/mol, XLogP of 1.88, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;(4-methylphenyl)-(4-propan-2-ylphenyl)iodanium is sourced from PubChem (CID 160535217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).