C23H24ClF3N2OS — CID 159711744
(5R)-5-[5-[(3-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)methyl]-2-fluorophenyl]-6,6-difluoro-5,7,7-trimethyl-1,4-oxazepane-3-thione (PubChem CID 159711744) has the molecular formula C23H24ClF3N2OS and a molecular weight of 468.97 g/mol. Its IUPAC name is (5R)-5-[5-[(3-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)methyl]-2-fluorophenyl]-6,6-difluoro-5,7,7-trimethyl-1,4-oxazepane-3-thione.
| Compound Name | (5R)-5-[5-[(3-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)methyl]-2-fluorophenyl]-6,6-difluoro-5,7,7-trimethyl-1,4-oxazepane-3-thione |
|---|---|
| PubChem CID | 159711744 |
| Molecular Formula | C23H24ClF3N2OS |
| Molecular Weight | 468.97 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | (5R)-5-[5-[(3-chloro-6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)methyl]-2-fluorophenyl]-6,6-difluoro-5,7,7-trimethyl-1,4-oxazepane-3-thione |
| SMILES | CC1(C)OCC(=S)N[C@](C)(c2cc(CC3CCc4cc(Cl)cnc43)ccc2F)C1(F)F |
| InChI | InChI=1S/C23H24ClF3N2OS/c1-21(2)23(26,27)22(3,29-19(31)12-30-21)17-9-13(4-7-18(17)25)8-14-5-6-15-10-16(24)11-28-20(14)15/h4,7,9-11,14H,5-6,8,12H2,1-3H3,(H,29,31)/t14?,22-/m1/s1 |
| InChIKey | MYXRDXAKWDFIGC-PSRIUPCASA-N |
| XLogP | 5.72 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.97 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|