C19H19ClF3N3OS — CID 88898095
5-[5-[(6-chloro-3-pyridinyl)amino]-2-fluorophenyl]-6,6-difluoro-5,7,7-trimethyl-1,4-oxazepane-3-thione (PubChem CID 88898095) has the molecular formula C19H19ClF3N3OS and a molecular weight of 429.90 g/mol. Its IUPAC name is 5-[5-[(6-chloro-3-pyridinyl)amino]-2-fluorophenyl]-6,6-difluoro-5,7,7-trimethyl-1,4-oxazepane-3-thione.
| Compound Name | 5-[5-[(6-chloro-3-pyridinyl)amino]-2-fluorophenyl]-6,6-difluoro-5,7,7-trimethyl-1,4-oxazepane-3-thione |
|---|---|
| PubChem CID | 88898095 |
| Molecular Formula | C19H19ClF3N3OS |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 5-[5-[(6-chloro-3-pyridinyl)amino]-2-fluorophenyl]-6,6-difluoro-5,7,7-trimethyl-1,4-oxazepane-3-thione |
| SMILES | CC1(C)OCC(=S)NC(C)(c2cc(Nc3ccc(Cl)nc3)ccc2F)C1(F)F |
| InChI | InChI=1S/C19H19ClF3N3OS/c1-17(2)19(22,23)18(3,26-16(28)10-27-17)13-8-11(4-6-14(13)21)25-12-5-7-15(20)24-9-12/h4-9,25H,10H2,1-3H3,(H,26,28) |
| InChIKey | GTRZUAUZURWBJC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|