C22H24F2N4S — CID 159713480
4-[3-(1,1-difluoroethyl)phenyl]-N-(5-methyl-1,3-dihydroindol-2-ylidene)piperazine-1-carbothioamide (PubChem CID 159713480) has the molecular formula C22H24F2N4S and a molecular weight of 414.53 g/mol. Its IUPAC name is 4-[3-(1,1-difluoroethyl)phenyl]-N-(5-methyl-1,3-dihydroindol-2-ylidene)piperazine-1-carbothioamide.
| Compound Name | 4-[3-(1,1-difluoroethyl)phenyl]-N-(5-methyl-1,3-dihydroindol-2-ylidene)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 159713480 |
| Molecular Formula | C22H24F2N4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 4-[3-(1,1-difluoroethyl)phenyl]-N-(5-methyl-1,3-dihydroindol-2-ylidene)piperazine-1-carbothioamide |
| SMILES | Cc1ccc2c(c1)CC(=NC(=S)N1CCN(c3cccc(C(C)(F)F)c3)CC1)N2 |
| InChI | InChI=1S/C22H24F2N4S/c1-15-6-7-19-16(12-15)13-20(25-19)26-21(29)28-10-8-27(9-11-28)18-5-3-4-17(14-18)22(2,23)24/h3-7,12,14H,8-11,13H2,1-2H3,(H,25,26,29) |
| InChIKey | QTJSOIZUPVENAB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|