C21H22F2N4S — CID 161116626
4-[3-(1,1-difluoroethyl)phenyl]-N-(1,3-dihydroindol-2-ylidene)piperazine-1-carbothioamide (PubChem CID 161116626) has the molecular formula C21H22F2N4S and a molecular weight of 400.50 g/mol. Its IUPAC name is 4-[3-(1,1-difluoroethyl)phenyl]-N-(1,3-dihydroindol-2-ylidene)piperazine-1-carbothioamide.
| Compound Name | 4-[3-(1,1-difluoroethyl)phenyl]-N-(1,3-dihydroindol-2-ylidene)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 161116626 |
| Molecular Formula | C21H22F2N4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 4-[3-(1,1-difluoroethyl)phenyl]-N-(1,3-dihydroindol-2-ylidene)piperazine-1-carbothioamide |
| SMILES | CC(F)(F)c1cccc(N2CCN(C(=S)N=C3Cc4ccccc4N3)CC2)c1 |
| InChI | InChI=1S/C21H22F2N4S/c1-21(22,23)16-6-4-7-17(14-16)26-9-11-27(12-10-26)20(28)25-19-13-15-5-2-3-8-18(15)24-19/h2-8,14H,9-13H2,1H3,(H,24,25,28) |
| InChIKey | DICODFLHJXWMTL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|