About 6-hydroxy-2-(methylamino)hexanenitrile;5-hydroxypentanal
6-hydroxy-2-(methylamino)hexanenitrile;5-hydroxypentanal (PubChem CID 159715785) has the molecular formula C12H24N2O3
and a molecular weight of 244.33 g/mol. Its IUPAC name is 6-hydroxy-2-(methylamino)hexanenitrile;5-hydroxypentanal.
Molecular Properties
| Compound Name | 6-hydroxy-2-(methylamino)hexanenitrile;5-hydroxypentanal |
| PubChem CID | 159715785 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 6-hydroxy-2-(methylamino)hexanenitrile;5-hydroxypentanal |
| SMILES | CNC(C#N)CCCCO.O=CCCCCO |
| InChI | InChI=1S/C7H14N2O.C5H10O2/c1-9-7(6-8)4-2-3-5-10;6-4-2-1-3-5-7/h7,9-10H,2-5H2,1H3;4,7H,1-3,5H2 |
| InChIKey | MZKIIEILGUJSIA-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxy-2-(methylamino)hexanenitrile;5-hydroxypentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-2-(methylamino)hexanenitrile;5-hydroxypentanal?
The IUPAC name of 6-hydroxy-2-(methylamino)hexanenitrile;5-hydroxypentanal (CID 159715785) is 6-hydroxy-2-(methylamino)hexanenitrile;5-hydroxypentanal.
What is the SMILES notation for 6-hydroxy-2-(methylamino)hexanenitrile;5-hydroxypentanal?
The canonical SMILES for 6-hydroxy-2-(methylamino)hexanenitrile;5-hydroxypentanal is CNC(C#N)CCCCO.O=CCCCCO.
What is the InChIKey of 6-hydroxy-2-(methylamino)hexanenitrile;5-hydroxypentanal?
The InChIKey is MZKIIEILGUJSIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O.C5H10O2/c1-9-7(6-8)4-2-3-5-10;6-4-2-1-3-5-7/h7,9-10H,2-5H2,1H3;4,7H,1-3,5H2.
What are the key properties of 6-hydroxy-2-(methylamino)hexanenitrile;5-hydroxypentanal?
6-hydroxy-2-(methylamino)hexanenitrile;5-hydroxypentanal has a molecular weight of 244.33 g/mol, XLogP of 0.61, 9 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-2-(methylamino)hexanenitrile;5-hydroxypentanal is sourced from PubChem (CID 159715785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).