C8H11ClN2 — CID 159716419
3-chloro-N,5-dimethyl-2-methylidenepyridin-1-amine (PubChem CID 159716419) has the molecular formula C8H11ClN2 and a molecular weight of 170.64 g/mol. Its IUPAC name is 3-chloro-N,5-dimethyl-2-methylidenepyridin-1-amine.
| Compound Name | 3-chloro-N,5-dimethyl-2-methylidenepyridin-1-amine |
|---|---|
| PubChem CID | 159716419 |
| Molecular Formula | C8H11ClN2 |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 3-chloro-N,5-dimethyl-2-methylidenepyridin-1-amine |
| SMILES | C=C1C(Cl)=CC(C)=CN1NC |
| InChI | InChI=1S/C8H11ClN2/c1-6-4-8(9)7(2)11(5-6)10-3/h4-5,10H,2H2,1,3H3 |
| InChIKey | RJOXVDLLHGQNDU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |