C19H21O7P — CID 159719026
5-[[methyl(phenylmethoxy)phosphoryl]oxymethyl]-2-phenyl-1,3-dioxolane-4-carboxylic acid (PubChem CID 159719026) has the molecular formula C19H21O7P and a molecular weight of 392.34 g/mol. Its IUPAC name is 5-[[methyl(phenylmethoxy)phosphoryl]oxymethyl]-2-phenyl-1,3-dioxolane-4-carboxylic acid.
| Compound Name | 5-[[methyl(phenylmethoxy)phosphoryl]oxymethyl]-2-phenyl-1,3-dioxolane-4-carboxylic acid |
|---|---|
| PubChem CID | 159719026 |
| Molecular Formula | C19H21O7P |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 5-[[methyl(phenylmethoxy)phosphoryl]oxymethyl]-2-phenyl-1,3-dioxolane-4-carboxylic acid |
| SMILES | CP(=O)(OCc1ccccc1)OCC1OC(c2ccccc2)OC1C(=O)O |
| InChI | InChI=1S/C19H21O7P/c1-27(22,23-12-14-8-4-2-5-9-14)24-13-16-17(18(20)21)26-19(25-16)15-10-6-3-7-11-15/h2-11,16-17,19H,12-13H2,1H3,(H,20,21) |
| InChIKey | RGDXCZKLCIWXKX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|