C44H47O8P — CID 10963683
(4S,5R,6S,7S)-2-phenyl-5,6-bis(phenylmethoxy)-4-(phenylmethoxymethyl)-7-[[phenylmethoxy(prop-2-enoxy)phosphoryl]methyl]-1,3-dioxepane (PubChem CID 10963683) has the molecular formula C44H47O8P and a molecular weight of 734.83 g/mol. Its IUPAC name is (4S,5R,6S,7S)-2-phenyl-5,6-bis(phenylmethoxy)-4-(phenylmethoxymethyl)-7-[[phenylmethoxy(prop-2-enoxy)phosphoryl]methyl]-1,3-dioxepane.
| Compound Name | (4S,5R,6S,7S)-2-phenyl-5,6-bis(phenylmethoxy)-4-(phenylmethoxymethyl)-7-[[phenylmethoxy(prop-2-enoxy)phosphoryl]methyl]-1,3-dioxepane |
|---|---|
| PubChem CID | 10963683 |
| Molecular Formula | C44H47O8P |
| Molecular Weight | 734.83 g/mol |
| Exact Mass | 734.30 |
| IUPAC Name | (4S,5R,6S,7S)-2-phenyl-5,6-bis(phenylmethoxy)-4-(phenylmethoxymethyl)-7-[[phenylmethoxy(prop-2-enoxy)phosphoryl]methyl]-1,3-dioxepane |
| SMILES | C=CCOP(=O)(C[C@H]1OC(c2ccccc2)O[C@@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C44H47O8P/c1-2-28-49-53(45,50-32-38-24-14-6-15-25-38)34-41-43(48-31-37-22-12-5-13-23-37)42(47-30-36-20-10-4-11-21-36)40(33-46-29-35-18-8-3-9-19-35)51-44(52-41)39-26-16-7-17-27-39/h2-27,40-44H,1,28-34H2/t40-,41+,42-,43+,44?,53?/m0/s1 |
| InChIKey | VGFVKCJSTVCZPR-YZWKAJDXSA-N |
| XLogP | 9.47 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.83 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|