C28H18N2O2S — CID 159722607
2-[[4-(16-thia-9,13-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11(15)-hexaen-13-yl)cyclopenta-1,3-dien-1-yl]methylidene]indene-1,3-dione (PubChem CID 159722607) has the molecular formula C28H18N2O2S and a molecular weight of 446.53 g/mol. Its IUPAC name is 2-[[4-(16-thia-9,13-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11(15)-hexaen-13-yl)cyclopenta-1,3-dien-1-yl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[4-(16-thia-9,13-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11(15)-hexaen-13-yl)cyclopenta-1,3-dien-1-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 159722607 |
| Molecular Formula | C28H18N2O2S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 2-[[4-(16-thia-9,13-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-1,3,5,7,9,11(15)-hexaen-13-yl)cyclopenta-1,3-dien-1-yl]methylidene]indene-1,3-dione |
| SMILES | O=C1C(=CC2=CC=C(N3Cc4sc5cc6ccccc6nc5c4C3)C2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C28H18N2O2S/c31-27-19-6-2-3-7-20(19)28(32)21(27)12-16-9-10-18(11-16)30-14-22-25(15-30)33-24-13-17-5-1-4-8-23(17)29-26(22)24/h1-10,12-13H,11,14-15H2 |
| InChIKey | IABAZUANGULEAW-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|