C30H40N6O6S2 — CID 159724646
1-N,4-N-bis[2-amino-5-[3-(dimethylamino)propylsulfonyl]phenyl]benzene-1,4-dicarboxamide (PubChem CID 159724646) has the molecular formula C30H40N6O6S2 and a molecular weight of 644.82 g/mol. Its IUPAC name is 1-N,4-N-bis[2-amino-5-[3-(dimethylamino)propylsulfonyl]phenyl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[2-amino-5-[3-(dimethylamino)propylsulfonyl]phenyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 159724646 |
| Molecular Formula | C30H40N6O6S2 |
| Molecular Weight | 644.82 g/mol |
| Exact Mass | 644.25 |
| IUPAC Name | 1-N,4-N-bis[2-amino-5-[3-(dimethylamino)propylsulfonyl]phenyl]benzene-1,4-dicarboxamide |
| SMILES | CN(C)CCCS(=O)(=O)c1ccc(N)c(NC(=O)c2ccc(C(=O)Nc3cc(S(=O)(=O)CCCN(C)C)ccc3N)cc2)c1 |
| InChI | InChI=1S/C30H40N6O6S2/c1-35(2)15-5-17-43(39,40)23-11-13-25(31)27(19-23)33-29(37)21-7-9-22(10-8-21)30(38)34-28-20-24(12-14-26(28)32)44(41,42)18-6-16-36(3)4/h7-14,19-20H,5-6,15-18,31-32H2,1-4H3,(H,33,37)(H,34,38) |
| InChIKey | XPCAZNHASAHPFB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 185.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.82 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|