About azane;bis(2,4-bis(sulfanyl)pentanenitrile)
azane;bis(2,4-bis(sulfanyl)pentanenitrile) (PubChem CID 159728471) has the molecular formula C10H21N3S4
and a molecular weight of 311.57 g/mol. Its IUPAC name is azane;bis(2,4-bis(sulfanyl)pentanenitrile).
Molecular Properties
| Compound Name | azane;bis(2,4-bis(sulfanyl)pentanenitrile) |
| PubChem CID | 159728471 |
| Molecular Formula | C10H21N3S4 |
| Molecular Weight | 311.57 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | azane;bis(2,4-bis(sulfanyl)pentanenitrile) |
| SMILES | CC(S)CC(S)C#N.CC(S)CC(S)C#N.N |
| InChI | InChI=1S/2C5H9NS2.H3N/c2*1-4(7)2-5(8)3-6;/h2*4-5,7-8H,2H2,1H3;1H3 |
| InChIKey | IPCOGHVOPRPLEK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 82.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.57 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze azane;bis(2,4-bis(sulfanyl)pentanenitrile) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;bis(2,4-bis(sulfanyl)pentanenitrile)?
The IUPAC name of azane;bis(2,4-bis(sulfanyl)pentanenitrile) (CID 159728471) is azane;bis(2,4-bis(sulfanyl)pentanenitrile).
What is the SMILES notation for azane;bis(2,4-bis(sulfanyl)pentanenitrile)?
The canonical SMILES for azane;bis(2,4-bis(sulfanyl)pentanenitrile) is CC(S)CC(S)C#N.CC(S)CC(S)C#N.N.
What is the InChIKey of azane;bis(2,4-bis(sulfanyl)pentanenitrile)?
The InChIKey is IPCOGHVOPRPLEK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H9NS2.H3N/c2*1-4(7)2-5(8)3-6;/h2*4-5,7-8H,2H2,1H3;1H3.
What are the key properties of azane;bis(2,4-bis(sulfanyl)pentanenitrile)?
azane;bis(2,4-bis(sulfanyl)pentanenitrile) has a molecular weight of 311.57 g/mol, XLogP of 3.20, 4 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for azane;bis(2,4-bis(sulfanyl)pentanenitrile) is sourced from PubChem (CID 159728471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).