C24H35N3O2S — CID 159733442
N-[4-(diethylamino)phenyl]-5-methylnaphthalene-1-sulfonamide;ethane;methanamine (PubChem CID 159733442) has the molecular formula C24H35N3O2S and a molecular weight of 429.63 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-5-methylnaphthalene-1-sulfonamide;ethane;methanamine.
| Compound Name | N-[4-(diethylamino)phenyl]-5-methylnaphthalene-1-sulfonamide;ethane;methanamine |
|---|---|
| PubChem CID | 159733442 |
| Molecular Formula | C24H35N3O2S |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-5-methylnaphthalene-1-sulfonamide;ethane;methanamine |
| SMILES | CC.CCN(CC)c1ccc(NS(=O)(=O)c2cccc3c(C)cccc23)cc1.CN |
| InChI | InChI=1S/C21H24N2O2S.C2H6.CH5N/c1-4-23(5-2)18-14-12-17(13-15-18)22-26(24,25)21-11-7-9-19-16(3)8-6-10-20(19)21;2*1-2/h6-15,22H,4-5H2,1-3H3;1-2H3;2H2,1H3 |
| InChIKey | NBNJSLIRABMSIX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|