C14H10F3NO2 — CID 159741700
9-(trifluoromethoxy)-6,11-dihydrobenzo[c][1,5]benzoxazepine (PubChem CID 159741700) has the molecular formula C14H10F3NO2 and a molecular weight of 281.23 g/mol. Its IUPAC name is 9-(trifluoromethoxy)-6,11-dihydrobenzo[c][1,5]benzoxazepine.
| Compound Name | 9-(trifluoromethoxy)-6,11-dihydrobenzo[c][1,5]benzoxazepine |
|---|---|
| PubChem CID | 159741700 |
| Molecular Formula | C14H10F3NO2 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 9-(trifluoromethoxy)-6,11-dihydrobenzo[c][1,5]benzoxazepine |
| SMILES | FC(F)(F)Oc1ccc2c(c1)Nc1ccccc1OC2 |
| InChI | InChI=1S/C14H10F3NO2/c15-14(16,17)20-10-6-5-9-8-19-13-4-2-1-3-11(13)18-12(9)7-10/h1-7,18H,8H2 |
| InChIKey | NCNQYRGKBCSLSC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |