C41H37N5O7 — CID 159754384
6,7-dimethoxy-4-(2-naphthalen-2-ylethynyl)quinazoline;6,7-dimethoxy-N-(3,4,5-trimethoxyphenyl)quinazolin-4-amine (PubChem CID 159754384) has the molecular formula C41H37N5O7 and a molecular weight of 711.78 g/mol. Its IUPAC name is 6,7-dimethoxy-4-(2-naphthalen-2-ylethynyl)quinazoline;6,7-dimethoxy-N-(3,4,5-trimethoxyphenyl)quinazolin-4-amine.
| Compound Name | 6,7-dimethoxy-4-(2-naphthalen-2-ylethynyl)quinazoline;6,7-dimethoxy-N-(3,4,5-trimethoxyphenyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 159754384 |
| Molecular Formula | C41H37N5O7 |
| Molecular Weight | 711.78 g/mol |
| Exact Mass | 711.27 |
| IUPAC Name | 6,7-dimethoxy-4-(2-naphthalen-2-ylethynyl)quinazoline;6,7-dimethoxy-N-(3,4,5-trimethoxyphenyl)quinazolin-4-amine |
| SMILES | COc1cc2ncnc(C#Cc3ccc4ccccc4c3)c2cc1OC.COc1cc2ncnc(Nc3cc(OC)c(OC)c(OC)c3)c2cc1OC |
| InChI | InChI=1S/C22H16N2O2.C19H21N3O5/c1-25-21-12-18-19(23-14-24-20(18)13-22(21)26-2)10-8-15-7-9-16-5-3-4-6-17(16)11-15;1-23-14-8-12-13(9-15(14)24-2)20-10-21-19(12)22-11-6-16(25-3)18(27-5)17(7-11)26-4/h3-7,9,11-14H,1-2H3;6-10H,1-5H3,(H,20,21,22) |
| InChIKey | NEBHNZLITUGRJE-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.78 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|