C24H36N4O3S — CID 159760250
cyclopentylazanium;methane;2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfinyl]benzimidazol-1-ide (PubChem CID 159760250) has the molecular formula C24H36N4O3S and a molecular weight of 460.64 g/mol. Its IUPAC name is cyclopentylazanium;methane;2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfinyl]benzimidazol-1-ide.
| Compound Name | cyclopentylazanium;methane;2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfinyl]benzimidazol-1-ide |
|---|---|
| PubChem CID | 159760250 |
| Molecular Formula | C24H36N4O3S |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | cyclopentylazanium;methane;2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfinyl]benzimidazol-1-ide |
| SMILES | C.COCCCOc1ccnc(CS(=O)c2nc3ccccc3[n-]2)c1C.[NH3+]C1CCCC1 |
| InChI | InChI=1S/C18H20N3O3S.C5H11N.CH4/c1-13-16(19-9-8-17(13)24-11-5-10-23-2)12-25(22)18-20-14-6-3-4-7-15(14)21-18;6-5-3-1-2-4-5;/h3-4,6-9H,5,10-12H2,1-2H3;5H,1-4,6H2;1H4/q-1;;/p+1 |
| InChIKey | NETYOXXXBHQBTO-UHFFFAOYSA-O |
| XLogP | 3.43 |
| TPSA | 103.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|