About N-(4-chlorophenoxy)sulfinyl-4-methylthiadiazole-5-carboxamide;4-methylthiadiazole-5-carbonyl chloride
N-(4-chlorophenoxy)sulfinyl-4-methylthiadiazole-5-carboxamide;4-methylthiadiazole-5-carbonyl chloride (PubChem CID 159761930) has the molecular formula C14H11Cl2N5O4S3
and a molecular weight of 480.38 g/mol. Its IUPAC name is N-(4-chlorophenoxy)sulfinyl-4-methylthiadiazole-5-carboxamide;4-methylthiadiazole-5-carbonyl chloride.
Molecular Properties
| Compound Name | N-(4-chlorophenoxy)sulfinyl-4-methylthiadiazole-5-carboxamide;4-methylthiadiazole-5-carbonyl chloride |
| PubChem CID | 159761930 |
| Molecular Formula | C14H11Cl2N5O4S3 |
| Molecular Weight | 480.38 g/mol |
| Exact Mass | 478.94 |
| IUPAC Name | N-(4-chlorophenoxy)sulfinyl-4-methylthiadiazole-5-carboxamide;4-methylthiadiazole-5-carbonyl chloride |
| SMILES | Cc1nnsc1C(=O)Cl.Cc1nnsc1C(=O)NS(=O)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H8ClN3O3S2.C4H3ClN2OS/c1-6-9(18-14-12-6)10(15)13-19(16)17-8-4-2-7(11)3-5-8;1-2-3(4(5)8)9-7-6-2/h2-5H,1H3,(H,13,15);1H3 |
| InChIKey | NEZQROFGWICDGS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 124.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(4-chlorophenoxy)sulfinyl-4-methylthiadiazole-5-carboxamide;4-methylthiadiazole-5-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chlorophenoxy)sulfinyl-4-methylthiadiazole-5-carboxamide;4-methylthiadiazole-5-carbonyl chloride?
The IUPAC name of N-(4-chlorophenoxy)sulfinyl-4-methylthiadiazole-5-carboxamide;4-methylthiadiazole-5-carbonyl chloride (CID 159761930) is N-(4-chlorophenoxy)sulfinyl-4-methylthiadiazole-5-carboxamide;4-methylthiadiazole-5-carbonyl chloride.
What is the SMILES notation for N-(4-chlorophenoxy)sulfinyl-4-methylthiadiazole-5-carboxamide;4-methylthiadiazole-5-carbonyl chloride?
The canonical SMILES for N-(4-chlorophenoxy)sulfinyl-4-methylthiadiazole-5-carboxamide;4-methylthiadiazole-5-carbonyl chloride is Cc1nnsc1C(=O)Cl.Cc1nnsc1C(=O)NS(=O)Oc1ccc(Cl)cc1.
What is the InChIKey of N-(4-chlorophenoxy)sulfinyl-4-methylthiadiazole-5-carboxamide;4-methylthiadiazole-5-carbonyl chloride?
The InChIKey is NEZQROFGWICDGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClN3O3S2.C4H3ClN2OS/c1-6-9(18-14-12-6)10(15)13-19(16)17-8-4-2-7(11)3-5-8;1-2-3(4(5)8)9-7-6-2/h2-5H,1H3,(H,13,15);1H3.
What are the key properties of N-(4-chlorophenoxy)sulfinyl-4-methylthiadiazole-5-carboxamide;4-methylthiadiazole-5-carbonyl chloride?
N-(4-chlorophenoxy)sulfinyl-4-methylthiadiazole-5-carboxamide;4-methylthiadiazole-5-carbonyl chloride has a molecular weight of 480.38 g/mol, XLogP of 3.11, 5 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chlorophenoxy)sulfinyl-4-methylthiadiazole-5-carboxamide;4-methylthiadiazole-5-carbonyl chloride is sourced from PubChem (CID 159761930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).