C33H64BNO19P3S4 — CID 159765442
CID 159765442 (PubChem CID 159765442) has the molecular formula C33H64BNO19P3S4 and a molecular weight of 1010.86 g/mol.
| Compound Name | CID 159765442 |
|---|---|
| PubChem CID | 159765442 |
| Molecular Formula | C33H64BNO19P3S4 |
| Molecular Weight | 1010.86 g/mol |
| Exact Mass | 1010.23 |
| IUPAC Name | — |
| SMILES | CCCCOCCOCCNC(=O)OCCC.CSSCO[C@H]1C[C@H]([B]C#CCCC(=O)OCCCCOCSSC(C)(C)C)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C21H39BO15P3S4.C12H25NO4/c1-21(2,3)44-43-15-31-11-7-8-12-32-20(23)9-5-6-10-22-19-13-17(33-16-42-41-4)18(35-19)14-34-39(27,28)37-40(29,30)36-38(24,25)26;1-3-5-8-15-10-11-16-9-6-13-12(14)17-7-4-2/h17-19H,5,7-9,11-16H2,1-4H3,(H,27,28)(H,29,30)(H2,24,25,26);3-11H2,1-2H3,(H,13,14)/t17-,18+,19+;/m0./s1 |
| InChIKey | VNBPSAUPUWLBQW-JQPLGUQCSA-N |
| XLogP | 6.68 |
| TPSA | 270.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1010.86 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|