C24H47N4O13P3S2 — CID 174035388
[[(2R,5R)-3-[[[1-(4-azidobutanoylamino)-2-methylpropan-2-yl]disulfanyl]methoxy]-5-cyclodecyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 174035388) has the molecular formula C24H47N4O13P3S2 and a molecular weight of 756.71 g/mol. Its IUPAC name is [[(2R,5R)-3-[[[1-(4-azidobutanoylamino)-2-methylpropan-2-yl]disulfanyl]methoxy]-5-cyclodecyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,5R)-3-[[[1-(4-azidobutanoylamino)-2-methylpropan-2-yl]disulfanyl]methoxy]-5-cyclodecyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 174035388 |
| Molecular Formula | C24H47N4O13P3S2 |
| Molecular Weight | 756.71 g/mol |
| Exact Mass | 756.18 |
| IUPAC Name | [[(2R,5R)-3-[[[1-(4-azidobutanoylamino)-2-methylpropan-2-yl]disulfanyl]methoxy]-5-cyclodecyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC(C)(CNC(=O)CCCN=[N+]=[N-])SSCOC1C[C@H](C2CCCCCCCCC2)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C24H47N4O13P3S2/c1-24(2,17-26-23(29)13-10-14-27-28-25)46-45-18-37-21-15-20(19-11-8-6-4-3-5-7-9-12-19)39-22(21)16-38-43(33,34)41-44(35,36)40-42(30,31)32/h19-22H,3-18H2,1-2H3,(H,26,29)(H,33,34)(H,35,36)(H2,30,31,32)/t20-,21?,22-/m1/s1 |
| InChIKey | KKBJGGKENDBNDF-NHXNGRAPSA-N |
| XLogP | 6.34 |
| TPSA | 256.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.71 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|