C18H38NO13P3S2 — CID 167618678
2-(but-2-ynoxymethyldisulfanyl)-N,2-dimethylpropan-1-amine;[[(2R,5S)-3-ethoxy-5-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 167618678) has the molecular formula C18H38NO13P3S2 and a molecular weight of 633.55 g/mol. Its IUPAC name is 2-(but-2-ynoxymethyldisulfanyl)-N,2-dimethylpropan-1-amine;[[(2R,5S)-3-ethoxy-5-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | 2-(but-2-ynoxymethyldisulfanyl)-N,2-dimethylpropan-1-amine;[[(2R,5S)-3-ethoxy-5-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 167618678 |
| Molecular Formula | C18H38NO13P3S2 |
| Molecular Weight | 633.55 g/mol |
| Exact Mass | 633.10 |
| IUPAC Name | 2-(but-2-ynoxymethyldisulfanyl)-N,2-dimethylpropan-1-amine;[[(2R,5S)-3-ethoxy-5-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC#CCOCSSC(C)(C)CNC.CCOC1C[C@H](C)O[C@@H]1COP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C10H19NOS2.C8H19O12P3/c1-5-6-7-12-9-13-14-10(2,3)8-11-4;1-3-16-7-4-6(2)18-8(7)5-17-22(12,13)20-23(14,15)19-21(9,10)11/h11H,7-9H2,1-4H3;6-8H,3-5H2,1-2H3,(H,12,13)(H,14,15)(H2,9,10,11)/t;6-,7?,8+/m.0/s1 |
| InChIKey | MCVUAIXRBGVTLD-FPTUFBDJSA-N |
| XLogP | 3.28 |
| TPSA | 199.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|