C50H68O6Si7 — CID 159766078
trimethyl-[(methyl-phenyl-trimethylsilyloxysilyl)oxy-diphenylsilyl]oxysilane;2,6,6-trimethyl-2,4,4-triphenyl-1,3,5,2,4,6-trioxatrisilecane (PubChem CID 159766078) has the molecular formula C50H68O6Si7 and a molecular weight of 961.69 g/mol. Its IUPAC name is trimethyl-[(methyl-phenyl-trimethylsilyloxysilyl)oxy-diphenylsilyl]oxysilane;2,6,6-trimethyl-2,4,4-triphenyl-1,3,5,2,4,6-trioxatrisilecane.
| Compound Name | trimethyl-[(methyl-phenyl-trimethylsilyloxysilyl)oxy-diphenylsilyl]oxysilane;2,6,6-trimethyl-2,4,4-triphenyl-1,3,5,2,4,6-trioxatrisilecane |
|---|---|
| PubChem CID | 159766078 |
| Molecular Formula | C50H68O6Si7 |
| Molecular Weight | 961.69 g/mol |
| Exact Mass | 960.34 |
| IUPAC Name | trimethyl-[(methyl-phenyl-trimethylsilyloxysilyl)oxy-diphenylsilyl]oxysilane;2,6,6-trimethyl-2,4,4-triphenyl-1,3,5,2,4,6-trioxatrisilecane |
| SMILES | C[Si](C)(C)O[Si](C)(O[Si](O[Si](C)(C)C)(c1ccccc1)c1ccccc1)c1ccccc1.C[Si]1(C)CCCCO[Si](C)(c2ccccc2)O[Si](c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C25H36O3Si4.C25H32O3Si3/c1-29(2,3)26-31(7,23-17-11-8-12-18-23)28-32(27-30(4,5)6,24-19-13-9-14-20-24)25-21-15-10-16-22-25;1-29(2)22-14-13-21-26-30(3,23-15-7-4-8-16-23)28-31(27-29,24-17-9-5-10-18-24)25-19-11-6-12-20-25/h8-22H,1-7H3;4-12,15-20H,13-14,21-22H2,1-3H3 |
| InChIKey | NFNBNEMFFCGHEZ-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 961.69 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|