C14H22N2O3 — CID 159768046
methyl 2-[(3aR,6R,8aS)-8-oxo-6-propyl-1,2,3,3a,6,8a-hexahydropyrrolo[2,3-c]azepin-7-yl]acetate (PubChem CID 159768046) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is methyl 2-[(3aR,6R,8aS)-8-oxo-6-propyl-1,2,3,3a,6,8a-hexahydropyrrolo[2,3-c]azepin-7-yl]acetate.
| Compound Name | methyl 2-[(3aR,6R,8aS)-8-oxo-6-propyl-1,2,3,3a,6,8a-hexahydropyrrolo[2,3-c]azepin-7-yl]acetate |
|---|---|
| PubChem CID | 159768046 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | methyl 2-[(3aR,6R,8aS)-8-oxo-6-propyl-1,2,3,3a,6,8a-hexahydropyrrolo[2,3-c]azepin-7-yl]acetate |
| SMILES | CCC[C@@H]1C=C[C@H]2CCN[C@@H]2C(=O)N1CC(=O)OC |
| InChI | InChI=1S/C14H22N2O3/c1-3-4-11-6-5-10-7-8-15-13(10)14(18)16(11)9-12(17)19-2/h5-6,10-11,13,15H,3-4,7-9H2,1-2H3/t10-,11+,13-/m0/s1 |
| InChIKey | RNKPPJPSXKZTIK-LOWVWBTDSA-N |
| XLogP | 0.70 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|