C19H16N3+ — CID 159791463
4,19-dimethyl-2,9-diaza-19-azoniapentacyclo[10.8.0.02,10.03,8.015,20]icosa-1(12),3,5,7,9,13,15(20),16,18-nonaene (PubChem CID 159791463) has the molecular formula C19H16N3+ and a molecular weight of 286.36 g/mol. Its IUPAC name is 4,19-dimethyl-2,9-diaza-19-azoniapentacyclo[10.8.0.02,10.03,8.015,20]icosa-1(12),3,5,7,9,13,15(20),16,18-nonaene.
| Compound Name | 4,19-dimethyl-2,9-diaza-19-azoniapentacyclo[10.8.0.02,10.03,8.015,20]icosa-1(12),3,5,7,9,13,15(20),16,18-nonaene |
|---|---|
| PubChem CID | 159791463 |
| Molecular Formula | C19H16N3+ |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 4,19-dimethyl-2,9-diaza-19-azoniapentacyclo[10.8.0.02,10.03,8.015,20]icosa-1(12),3,5,7,9,13,15(20),16,18-nonaene |
| SMILES | Cc1cccc2nc3n(c12)-c1c(ccc2ccc[n+](C)c12)C3 |
| InChI | InChI=1S/C19H16N3/c1-12-5-3-7-15-17(12)22-16(20-15)11-14-9-8-13-6-4-10-21(2)18(13)19(14)22/h3-10H,11H2,1-2H3/q+1 |
| InChIKey | KYKLJLPUCWNAEE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|