C13H13N3+2 — CID 156662553
1,10-dimethylpyrido[2,3-f]quinoxaline-1,10-diium (PubChem CID 156662553) has the molecular formula C13H13N3+2 and a molecular weight of 211.27 g/mol. Its IUPAC name is 1,10-dimethylpyrido[2,3-f]quinoxaline-1,10-diium.
| Compound Name | 1,10-dimethylpyrido[2,3-f]quinoxaline-1,10-diium |
|---|---|
| PubChem CID | 156662553 |
| Molecular Formula | C13H13N3+2 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 1,10-dimethylpyrido[2,3-f]quinoxaline-1,10-diium |
| SMILES | C[n+]1cccc2ccc3ncc[n+](C)c3c21 |
| InChI | InChI=1S/C13H13N3/c1-15-8-3-4-10-5-6-11-13(12(10)15)16(2)9-7-14-11/h3-9H,1-2H3/q+2 |
| InChIKey | ZACKPWVDOCOGAH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 20.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|