C14H12BrN2+ — CID 102246001
1-(2-bromoethyl)-1,7-phenanthrolin-1-ium (PubChem CID 102246001) has the molecular formula C14H12BrN2+ and a molecular weight of 288.17 g/mol. Its IUPAC name is 1-(2-bromoethyl)-1,7-phenanthrolin-1-ium.
| Compound Name | 1-(2-bromoethyl)-1,7-phenanthrolin-1-ium |
|---|---|
| PubChem CID | 102246001 |
| Molecular Formula | C14H12BrN2+ |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 1-(2-bromoethyl)-1,7-phenanthrolin-1-ium |
| SMILES | BrCC[n+]1cccc2ccc3ncccc3c21 |
| InChI | InChI=1S/C14H12BrN2/c15-7-10-17-9-2-3-11-5-6-13-12(14(11)17)4-1-8-16-13/h1-6,8-9H,7,10H2/q+1 |
| InChIKey | WRAGIOKICPHVMG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|