C25H37IN2O7 — CID 159794130
2-(4-aminophenyl)acetic acid;2-[4-[bis(3-hydroxypropyl)amino]phenyl]acetic acid;3-iodopropan-1-ol (PubChem CID 159794130) has the molecular formula C25H37IN2O7 and a molecular weight of 604.48 g/mol. Its IUPAC name is 2-(4-aminophenyl)acetic acid;2-[4-[bis(3-hydroxypropyl)amino]phenyl]acetic acid;3-iodopropan-1-ol.
| Compound Name | 2-(4-aminophenyl)acetic acid;2-[4-[bis(3-hydroxypropyl)amino]phenyl]acetic acid;3-iodopropan-1-ol |
|---|---|
| PubChem CID | 159794130 |
| Molecular Formula | C25H37IN2O7 |
| Molecular Weight | 604.48 g/mol |
| Exact Mass | 604.16 |
| IUPAC Name | 2-(4-aminophenyl)acetic acid;2-[4-[bis(3-hydroxypropyl)amino]phenyl]acetic acid;3-iodopropan-1-ol |
| SMILES | Nc1ccc(CC(=O)O)cc1.O=C(O)Cc1ccc(N(CCCO)CCCO)cc1.OCCCI |
| InChI | InChI=1S/C14H21NO4.C8H9NO2.C3H7IO/c16-9-1-7-15(8-2-10-17)13-5-3-12(4-6-13)11-14(18)19;9-7-3-1-6(2-4-7)5-8(10)11;4-2-1-3-5/h3-6,16-17H,1-2,7-11H2,(H,18,19);1-4H,5,9H2,(H,10,11);5H,1-3H2 |
| InChIKey | NIYHYNUGTBRSNC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 164.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|