About 2-[3-[4-amino-N-(2-hydroxyethyl)anilino]propylamino]ethanol;trihydrate;trihydrochloride
2-[3-[4-amino-N-(2-hydroxyethyl)anilino]propylamino]ethanol;trihydrate;trihydrochloride (PubChem CID 70549305) has the molecular formula C13H32Cl3N3O5
and a molecular weight of 416.77 g/mol. Its IUPAC name is 2-[3-[4-amino-N-(2-hydroxyethyl)anilino]propylamino]ethanol;trihydrate;trihydrochloride.
Molecular Properties
| Compound Name | 2-[3-[4-amino-N-(2-hydroxyethyl)anilino]propylamino]ethanol;trihydrate;trihydrochloride |
| PubChem CID | 70549305 |
| Molecular Formula | C13H32Cl3N3O5 |
| Molecular Weight | 416.77 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 2-[3-[4-amino-N-(2-hydroxyethyl)anilino]propylamino]ethanol;trihydrate;trihydrochloride |
| SMILES | Cl.Cl.Cl.Nc1ccc(N(CCO)CCCNCCO)cc1.O.O.O |
| InChI | InChI=1S/C13H23N3O2.3ClH.3H2O/c14-12-2-4-13(5-3-12)16(9-11-18)8-1-6-15-7-10-17;;;;;;/h2-5,15,17-18H,1,6-11,14H2;3*1H;3*1H2 |
| InChIKey | YZDSQEFKQJFQGN-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 176.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.77 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[4-amino-N-(2-hydroxyethyl)anilino]propylamino]ethanol;trihydrate;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[4-amino-N-(2-hydroxyethyl)anilino]propylamino]ethanol;trihydrate;trihydrochloride?
The IUPAC name of 2-[3-[4-amino-N-(2-hydroxyethyl)anilino]propylamino]ethanol;trihydrate;trihydrochloride (CID 70549305) is 2-[3-[4-amino-N-(2-hydroxyethyl)anilino]propylamino]ethanol;trihydrate;trihydrochloride.
What is the SMILES notation for 2-[3-[4-amino-N-(2-hydroxyethyl)anilino]propylamino]ethanol;trihydrate;trihydrochloride?
The canonical SMILES for 2-[3-[4-amino-N-(2-hydroxyethyl)anilino]propylamino]ethanol;trihydrate;trihydrochloride is Cl.Cl.Cl.Nc1ccc(N(CCO)CCCNCCO)cc1.O.O.O.
What is the InChIKey of 2-[3-[4-amino-N-(2-hydroxyethyl)anilino]propylamino]ethanol;trihydrate;trihydrochloride?
The InChIKey is YZDSQEFKQJFQGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O2.3ClH.3H2O/c14-12-2-4-13(5-3-12)16(9-11-18)8-1-6-15-7-10-17;;;;;;/h2-5,15,17-18H,1,6-11,14H2;3*1H;3*1H2.
What are the key properties of 2-[3-[4-amino-N-(2-hydroxyethyl)anilino]propylamino]ethanol;trihydrate;trihydrochloride?
2-[3-[4-amino-N-(2-hydroxyethyl)anilino]propylamino]ethanol;trihydrate;trihydrochloride has a molecular weight of 416.77 g/mol, XLogP of -1.17, 9 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[4-amino-N-(2-hydroxyethyl)anilino]propylamino]ethanol;trihydrate;trihydrochloride is sourced from PubChem (CID 70549305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).