C19H30O7 — CID 159806018
butanedioic acid;1-(1-hydroxypropan-2-yloxy)-6-phenylhexan-2-ol (PubChem CID 159806018) has the molecular formula C19H30O7 and a molecular weight of 370.44 g/mol. Its IUPAC name is butanedioic acid;1-(1-hydroxypropan-2-yloxy)-6-phenylhexan-2-ol.
| Compound Name | butanedioic acid;1-(1-hydroxypropan-2-yloxy)-6-phenylhexan-2-ol |
|---|---|
| PubChem CID | 159806018 |
| Molecular Formula | C19H30O7 |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | butanedioic acid;1-(1-hydroxypropan-2-yloxy)-6-phenylhexan-2-ol |
| SMILES | CC(CO)OCC(O)CCCCc1ccccc1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C15H24O3.C4H6O4/c1-13(11-16)18-12-15(17)10-6-5-9-14-7-3-2-4-8-14;5-3(6)1-2-4(7)8/h2-4,7-8,13,15-17H,5-6,9-12H2,1H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | NKKCQKWWLRDAAE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|