C19H20Cl2F2NO3+ — CID 159814042
(1S)-1-[3-(cyclopropyloxymethyl)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-methylpyridin-1-ium-4-yl)ethanol (PubChem CID 159814042) has the molecular formula C19H20Cl2F2NO3+ and a molecular weight of 419.28 g/mol. Its IUPAC name is (1S)-1-[3-(cyclopropyloxymethyl)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-methylpyridin-1-ium-4-yl)ethanol.
| Compound Name | (1S)-1-[3-(cyclopropyloxymethyl)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-methylpyridin-1-ium-4-yl)ethanol |
|---|---|
| PubChem CID | 159814042 |
| Molecular Formula | C19H20Cl2F2NO3+ |
| Molecular Weight | 419.28 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | (1S)-1-[3-(cyclopropyloxymethyl)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-methylpyridin-1-ium-4-yl)ethanol |
| SMILES | C[n+]1cc(Cl)c(C[C@H](O)c2ccc(OC(F)F)c(COC3CC3)c2)c(Cl)c1 |
| InChI | InChI=1S/C19H20Cl2F2NO3/c1-24-8-15(20)14(16(21)9-24)7-17(25)11-2-5-18(27-19(22)23)12(6-11)10-26-13-3-4-13/h2,5-6,8-9,13,17,19,25H,3-4,7,10H2,1H3/q+1/t17-/m0/s1 |
| InChIKey | GNDDCNYOHBGIHS-KRWDZBQOSA-N |
| XLogP | 4.37 |
| TPSA | 42.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.28 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|