C17H17Cl2F2NO4 — CID 90186728
2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1-[4-(difluoromethoxy)-3-propoxyphenyl]ethanol (PubChem CID 90186728) has the molecular formula C17H17Cl2F2NO4 and a molecular weight of 408.23 g/mol. Its IUPAC name is 2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1-[4-(difluoromethoxy)-3-propoxyphenyl]ethanol.
| Compound Name | 2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1-[4-(difluoromethoxy)-3-propoxyphenyl]ethanol |
|---|---|
| PubChem CID | 90186728 |
| Molecular Formula | C17H17Cl2F2NO4 |
| Molecular Weight | 408.23 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | 2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1-[4-(difluoromethoxy)-3-propoxyphenyl]ethanol |
| SMILES | CCCOc1cc(C(O)Cc2c(Cl)c[n+]([O-])cc2Cl)ccc1OC(F)F |
| InChI | InChI=1S/C17H17Cl2F2NO4/c1-2-5-25-16-6-10(3-4-15(16)26-17(20)21)14(23)7-11-12(18)8-22(24)9-13(11)19/h3-4,6,8-9,14,17,23H,2,5,7H2,1H3 |
| InChIKey | PEGMURISKOAOHJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.23 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|