C15H13Cl2F2NO4 — CID 118117236
2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1-[2,3,6-trideuterio-4-(difluoromethoxy)-5-methoxyphenyl]ethanol (PubChem CID 118117236) has the molecular formula C15H13Cl2F2NO4 and a molecular weight of 383.19 g/mol. Its IUPAC name is 2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1-[2,3,6-trideuterio-4-(difluoromethoxy)-5-methoxyphenyl]ethanol.
| Compound Name | 2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1-[2,3,6-trideuterio-4-(difluoromethoxy)-5-methoxyphenyl]ethanol |
|---|---|
| PubChem CID | 118117236 |
| Molecular Formula | C15H13Cl2F2NO4 |
| Molecular Weight | 383.19 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1-[2,3,6-trideuterio-4-(difluoromethoxy)-5-methoxyphenyl]ethanol |
| SMILES | [2H]c1c([2H])c(C(O)Cc2c(Cl)c[n+]([O-])cc2Cl)c([2H])c(OC)c1OC(F)F |
| InChI | InChI=1S/C15H13Cl2F2NO4/c1-23-14-4-8(2-3-13(14)24-15(18)19)12(21)5-9-10(16)6-20(22)7-11(9)17/h2-4,6-7,12,15,21H,5H2,1H3/i2D,3D,4D |
| InChIKey | FUCFLINELPEUMS-NRUYWUNFSA-N |
| XLogP | 3.51 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.19 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|