C24H21Cl2F2NO7 — CID 89266640
[2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1-[4-(difluoromethoxy)-3-hydroxyphenyl]ethyl] acetate;phenyl acetate (PubChem CID 89266640) has the molecular formula C24H21Cl2F2NO7 and a molecular weight of 544.33 g/mol. Its IUPAC name is [2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1-[4-(difluoromethoxy)-3-hydroxyphenyl]ethyl] acetate;phenyl acetate.
| Compound Name | [2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1-[4-(difluoromethoxy)-3-hydroxyphenyl]ethyl] acetate;phenyl acetate |
|---|---|
| PubChem CID | 89266640 |
| Molecular Formula | C24H21Cl2F2NO7 |
| Molecular Weight | 544.33 g/mol |
| Exact Mass | 543.07 |
| IUPAC Name | [2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1-[4-(difluoromethoxy)-3-hydroxyphenyl]ethyl] acetate;phenyl acetate |
| SMILES | CC(=O)OC(Cc1c(Cl)c[n+]([O-])cc1Cl)c1ccc(OC(F)F)c(O)c1.CC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C16H13Cl2F2NO5.C8H8O2/c1-8(22)25-15(5-10-11(17)6-21(24)7-12(10)18)9-2-3-14(13(23)4-9)26-16(19)20;1-7(9)10-8-5-3-2-4-6-8/h2-4,6-7,15-16,23H,5H2,1H3;2-6H,1H3 |
| InChIKey | PPUIILCTWCDWGH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.33 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|