C19H13Cl2F2NO5S — CID 86703869
[(1S)-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1-[4-(difluoromethoxy)-3-hydroxyphenyl]ethyl] thiophene-2-carboxylate (PubChem CID 86703869) has the molecular formula C19H13Cl2F2NO5S and a molecular weight of 476.28 g/mol. Its IUPAC name is [(1S)-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1-[4-(difluoromethoxy)-3-hydroxyphenyl]ethyl] thiophene-2-carboxylate.
| Compound Name | [(1S)-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1-[4-(difluoromethoxy)-3-hydroxyphenyl]ethyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 86703869 |
| Molecular Formula | C19H13Cl2F2NO5S |
| Molecular Weight | 476.28 g/mol |
| Exact Mass | 474.99 |
| IUPAC Name | [(1S)-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1-[4-(difluoromethoxy)-3-hydroxyphenyl]ethyl] thiophene-2-carboxylate |
| SMILES | O=C(O[C@@H](Cc1c(Cl)c[n+]([O-])cc1Cl)c1ccc(OC(F)F)c(O)c1)c1cccs1 |
| InChI | InChI=1S/C19H13Cl2F2NO5S/c20-12-8-24(27)9-13(21)11(12)7-16(28-18(26)17-2-1-5-30-17)10-3-4-15(14(25)6-10)29-19(22)23/h1-6,8-9,16,19,25H,7H2/t16-/m0/s1 |
| InChIKey | JTGDMNGNXQNSTD-INIZCTEOSA-N |
| XLogP | 5.14 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.28 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|