C30H69N3 — CID 159829459
N,N-bis(2,2-dimethylpropyl)-2,2-dimethylpropan-1-amine;2,2-dimethylpropan-1-amine;N-(2,2-dimethylpropyl)-2,2-dimethylpropan-1-amine (PubChem CID 159829459) has the molecular formula C30H69N3 and a molecular weight of 471.90 g/mol. Its IUPAC name is N,N-bis(2,2-dimethylpropyl)-2,2-dimethylpropan-1-amine;2,2-dimethylpropan-1-amine;N-(2,2-dimethylpropyl)-2,2-dimethylpropan-1-amine.
| Compound Name | N,N-bis(2,2-dimethylpropyl)-2,2-dimethylpropan-1-amine;2,2-dimethylpropan-1-amine;N-(2,2-dimethylpropyl)-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 159829459 |
| Molecular Formula | C30H69N3 |
| Molecular Weight | 471.90 g/mol |
| Exact Mass | 471.55 |
| IUPAC Name | N,N-bis(2,2-dimethylpropyl)-2,2-dimethylpropan-1-amine;2,2-dimethylpropan-1-amine;N-(2,2-dimethylpropyl)-2,2-dimethylpropan-1-amine |
| SMILES | CC(C)(C)CN.CC(C)(C)CN(CC(C)(C)C)CC(C)(C)C.CC(C)(C)CNCC(C)(C)C |
| InChI | InChI=1S/C15H33N.C10H23N.C5H13N/c1-13(2,3)10-16(11-14(4,5)6)12-15(7,8)9;1-9(2,3)7-11-8-10(4,5)6;1-5(2,3)4-6/h10-12H2,1-9H3;11H,7-8H2,1-6H3;4,6H2,1-3H3 |
| InChIKey | NNGSNXUEPRNGAV-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.90 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |